C28H36N4O3 — CID 46902608
[1-[(3R,4R,6R)-1-hexyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate (PubChem CID 46902608) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is [1-[(3R,4R,6R)-1-hexyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate.
| Compound Name | [1-[(3R,4R,6R)-1-hexyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 46902608 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [1-[(3R,4R,6R)-1-hexyl-4-hydroxy-6-(4-methylphenyl)piperidin-3-yl]triazol-4-yl]methyl benzoate |
| SMILES | CCCCCCN1C[C@@H](n2cc(COC(=O)c3ccccc3)nn2)[C@H](O)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C28H36N4O3/c1-3-4-5-9-16-31-19-26(27(33)17-25(31)22-14-12-21(2)13-15-22)32-18-24(29-30-32)20-35-28(34)23-10-7-6-8-11-23/h6-8,10-15,18,25-27,33H,3-5,9,16-17,19-20H2,1-2H3/t25-,26-,27-/m1/s1 |
| InChIKey | IZGOAAVPFZZHBM-ZONZVBGPSA-N |
| XLogP | 4.87 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|