About 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide
2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide (PubChem CID 46902740) has the molecular formula C26H26N2O3
and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide |
| PubChem CID | 46902740 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide |
| SMILES | COc1ccc([C@H]2CN(Cc3ccccc3)C(=O)[C@@H]2CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-31-22-14-12-20(13-15-22)24-18-28(17-19-8-4-2-5-9-19)26(30)23(24)16-25(29)27-21-10-6-3-7-11-21/h2-15,23-24H,16-18H2,1H3,(H,27,29)/t23-,24-/m1/s1 |
| InChIKey | WTRDBPOGCYSCRK-DNQXCXABSA-N |
| XLogP | 4.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The IUPAC name of 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide (CID 46902740) is 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The canonical SMILES for 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide is COc1ccc([C@H]2CN(Cc3ccccc3)C(=O)[C@@H]2CC(=O)Nc2ccccc2)cc1.
What is the InChIKey of 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The InChIKey is WTRDBPOGCYSCRK-DNQXCXABSA-N. The full InChI is InChI=1S/C26H26N2O3/c1-31-22-14-12-20(13-15-22)24-18-28(17-19-8-4-2-5-9-19)26(30)23(24)16-25(29)27-21-10-6-3-7-11-21/h2-15,23-24H,16-18H2,1H3,(H,27,29)/t23-,24-/m1/s1.
What are the key properties of 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide has a molecular weight of 414.51 g/mol, XLogP of 4.47, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide is sourced from PubChem (CID 46902740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).