C27H28N6 — CID 46902865
4-[2-ethyl-4-[3-(naphthalen-2-ylmethyl)triazol-4-yl]phenyl]-1-(2-methylpropyl)triazole (PubChem CID 46902865) has the molecular formula C27H28N6 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[2-ethyl-4-[3-(naphthalen-2-ylmethyl)triazol-4-yl]phenyl]-1-(2-methylpropyl)triazole.
| Compound Name | 4-[2-ethyl-4-[3-(naphthalen-2-ylmethyl)triazol-4-yl]phenyl]-1-(2-methylpropyl)triazole |
|---|---|
| PubChem CID | 46902865 |
| Molecular Formula | C27H28N6 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-[2-ethyl-4-[3-(naphthalen-2-ylmethyl)triazol-4-yl]phenyl]-1-(2-methylpropyl)triazole |
| SMILES | CCc1cc(-c2cnnn2Cc2ccc3ccccc3c2)ccc1-c1cn(CC(C)C)nn1 |
| InChI | InChI=1S/C27H28N6/c1-4-21-14-24(11-12-25(21)26-18-32(31-29-26)16-19(2)3)27-15-28-30-33(27)17-20-9-10-22-7-5-6-8-23(22)13-20/h5-15,18-19H,4,16-17H2,1-3H3 |
| InChIKey | LKIOGUVEPSVRSF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |