About N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide
N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide (PubChem CID 46902939) has the molecular formula C24H27BrN2O2
and a molecular weight of 455.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide |
| PubChem CID | 46902939 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide |
| SMILES | O=C(C[C@H]1C(=O)N(C2CCCCC2)C[C@@H]1c1ccccc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H27BrN2O2/c25-18-11-13-19(14-12-18)26-23(28)15-21-22(17-7-3-1-4-8-17)16-27(24(21)29)20-9-5-2-6-10-20/h1,3-4,7-8,11-14,20-22H,2,5-6,9-10,15-16H2,(H,26,28)/t21-,22-/m1/s1 |
| InChIKey | BFSGZDHFXOHUBS-FGZHOGPDSA-N |
| XLogP | 5.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide?
The IUPAC name of N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide (CID 46902939) is N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide?
The canonical SMILES for N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide is O=C(C[C@H]1C(=O)N(C2CCCCC2)C[C@@H]1c1ccccc1)Nc1ccc(Br)cc1.
What is the InChIKey of N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide?
The InChIKey is BFSGZDHFXOHUBS-FGZHOGPDSA-N. The full InChI is InChI=1S/C24H27BrN2O2/c25-18-11-13-19(14-12-18)26-23(28)15-21-22(17-7-3-1-4-8-17)16-27(24(21)29)20-9-5-2-6-10-20/h1,3-4,7-8,11-14,20-22H,2,5-6,9-10,15-16H2,(H,26,28)/t21-,22-/m1/s1.
What are the key properties of N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide?
N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide has a molecular weight of 455.40 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2-[(3R,4S)-1-cyclohexyl-2-oxo-4-phenylpyrrolidin-3-yl]acetamide is sourced from PubChem (CID 46902939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).