About 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide
2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide (PubChem CID 46903032) has the molecular formula C15H26N2O2
and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide |
| PubChem CID | 46903032 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@@H]1C(=O)N(C2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C15H26N2O2/c1-15(2)10-17(11-7-5-4-6-8-11)14(19)12(15)9-13(18)16-3/h11-12H,4-10H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | BYIFUEFFBVEESK-GFCCVEGCSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide?
The IUPAC name of 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide (CID 46903032) is 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide.
What is the SMILES notation for 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide?
The canonical SMILES for 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide is CNC(=O)C[C@@H]1C(=O)N(C2CCCCC2)CC1(C)C.
What is the InChIKey of 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide?
The InChIKey is BYIFUEFFBVEESK-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H26N2O2/c1-15(2)10-17(11-7-5-4-6-8-11)14(19)12(15)9-13(18)16-3/h11-12H,4-10H2,1-3H3,(H,16,18)/t12-/m1/s1.
What are the key properties of 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide?
2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide has a molecular weight of 266.38 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-1-cyclohexyl-4,4-dimethyl-2-oxopyrrolidin-3-yl]-N-methylacetamide is sourced from PubChem (CID 46903032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).