C26H31FN4O2 — CID 46903058
1-[(2R,4R,5R)-4-[4-(4-fluorophenyl)triazol-1-yl]-5-hydroxy-2-(4-methylphenyl)piperidin-1-yl]hexan-1-one (PubChem CID 46903058) has the molecular formula C26H31FN4O2 and a molecular weight of 450.56 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-[4-(4-fluorophenyl)triazol-1-yl]-5-hydroxy-2-(4-methylphenyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R,4R,5R)-4-[4-(4-fluorophenyl)triazol-1-yl]-5-hydroxy-2-(4-methylphenyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 46903058 |
| Molecular Formula | C26H31FN4O2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[(2R,4R,5R)-4-[4-(4-fluorophenyl)triazol-1-yl]-5-hydroxy-2-(4-methylphenyl)piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@@H](O)[C@H](n2cc(-c3ccc(F)cc3)nn2)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31FN4O2/c1-3-4-5-6-26(33)30-17-25(32)24(15-23(30)20-9-7-18(2)8-10-20)31-16-22(28-29-31)19-11-13-21(27)14-12-19/h7-14,16,23-25,32H,3-6,15,17H2,1-2H3/t23-,24-,25-/m1/s1 |
| InChIKey | DXTNBDZJUXFKHY-UBFVSLLYSA-N |
| XLogP | 4.85 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|