C22H30N4O2 — CID 46903181
1-[(2R,4R,5R)-5-(4-cyclopropyltriazol-1-yl)-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one (PubChem CID 46903181) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-(4-cyclopropyltriazol-1-yl)-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(2R,4R,5R)-5-(4-cyclopropyltriazol-1-yl)-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 46903181 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[(2R,4R,5R)-5-(4-cyclopropyltriazol-1-yl)-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@@H](n2cc(C3CC3)nn2)[C@H](O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H30N4O2/c1-2-3-5-10-22(28)25-15-20(26-14-18(23-24-26)16-11-12-16)21(27)13-19(25)17-8-6-4-7-9-17/h4,6-9,14,16,19-21,27H,2-3,5,10-13,15H2,1H3/t19-,20-,21-/m1/s1 |
| InChIKey | WMWAUVFKNWLWAX-NJDAHSKKSA-N |
| XLogP | 3.61 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|