C16H22O5 — CID 46903506
(1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methylspiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol (PubChem CID 46903506) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methylspiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol.
| Compound Name | (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methylspiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 46903506 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1R,3'R,4'S,6'R)-6'-(2-hydroxyethyl)-6-methylspiro[3,4-dihydroisochromene-1,2'-oxane]-3',4'-diol |
| SMILES | Cc1ccc2c(c1)CCO[C@@]21O[C@H](CCO)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22O5/c1-10-2-3-13-11(8-10)5-7-20-16(13)15(19)14(18)9-12(21-16)4-6-17/h2-3,8,12,14-15,17-19H,4-7,9H2,1H3/t12-,14+,15-,16-/m1/s1 |
| InChIKey | FVPOCBNLAJIXAW-SLBVQIDZSA-N |
| XLogP | 0.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |