C29H35N3O5 — CID 46903569
N-[[(2R,3S)-5-[(2S)-1-hydroxypropan-2-yl]-8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N-methylcyclobutanecarboxamide (PubChem CID 46903569) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[[(2R,3S)-5-[(2S)-1-hydroxypropan-2-yl]-8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[[(2R,3S)-5-[(2S)-1-hydroxypropan-2-yl]-8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 46903569 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | N-[[(2R,3S)-5-[(2S)-1-hydroxypropan-2-yl]-8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N-methylcyclobutanecarboxamide |
| SMILES | COc1cccc(C#Cc2cnc3c(c2)C(=O)N([C@@H](C)CO)C[C@H](C)[C@H](CN(C)C(=O)C2CCC2)O3)c1 |
| InChI | InChI=1S/C29H35N3O5/c1-19-16-32(20(2)18-33)29(35)25-14-22(12-11-21-7-5-10-24(13-21)36-4)15-30-27(25)37-26(19)17-31(3)28(34)23-8-6-9-23/h5,7,10,13-15,19-20,23,26,33H,6,8-9,16-18H2,1-4H3/t19-,20-,26-/m0/s1 |
| InChIKey | ONBMKWMQPPCEGH-DYLHXGEVSA-N |
| XLogP | 2.97 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|