About 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one
4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one (PubChem CID 46903643) has the molecular formula C21H24N4O
and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one |
| PubChem CID | 46903643 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CCCNCC(c2ccccc2)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C21H24N4O/c22-20-12-15-25(21(26)24-20)14-7-13-23-16-19(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-12,15,19,23H,7,13-14,16H2,(H2,22,24,26) |
| InChIKey | RBNZYRLNIJGQHK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one (CID 46903643) is 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one is Nc1ccn(CCCNCC(c2ccccc2)c2ccccc2)c(=O)n1.
What is the InChIKey of 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one?
The InChIKey is RBNZYRLNIJGQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O/c22-20-12-15-25(21(26)24-20)14-7-13-23-16-19(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-12,15,19,23H,7,13-14,16H2,(H2,22,24,26).
What are the key properties of 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one?
4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one has a molecular weight of 348.45 g/mol, XLogP of 2.64, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[3-(2,2-diphenylethylamino)propyl]pyrimidin-2-one is sourced from PubChem (CID 46903643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).