C18H22N6O6 — CID 46903675
(2R)-N-[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-formamido-3-pyridin-3-ylpropanamide (PubChem CID 46903675) has the molecular formula C18H22N6O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is (2R)-N-[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-formamido-3-pyridin-3-ylpropanamide.
| Compound Name | (2R)-N-[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-formamido-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 46903675 |
| Molecular Formula | C18H22N6O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R)-N-[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-formamido-3-pyridin-3-ylpropanamide |
| SMILES | Nc1ccn([C@@H]2O[C@H](CNC(=O)[C@@H](Cc3cccnc3)NC=O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C18H22N6O6/c19-13-3-5-24(18(29)23-13)17-15(27)14(26)12(30-17)8-21-16(28)11(22-9-25)6-10-2-1-4-20-7-10/h1-5,7,9,11-12,14-15,17,26-27H,6,8H2,(H,21,28)(H,22,25)(H2,19,23,29)/t11-,12-,14-,15-,17-/m1/s1 |
| InChIKey | QPXJNXUAZUUTBC-TYRDWNCCSA-N |
| XLogP | -2.69 |
| TPSA | 181.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|