C28H37N3O5S — CID 46903691
N-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-8-(4-methylpent-1-ynyl)-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 46903691) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is N-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-8-(4-methylpent-1-ynyl)-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-8-(4-methylpent-1-ynyl)-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 46903691 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-8-(4-methylpent-1-ynyl)-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C[C@@H]2Oc3ncc(C#CCC(C)C)cc3C(=O)N([C@H](C)CO)C[C@H]2C)cc1 |
| InChI | InChI=1S/C28H37N3O5S/c1-19(2)8-7-9-23-14-25-27(29-15-23)36-26(21(4)16-31(28(25)33)22(5)18-32)17-30(6)37(34,35)24-12-10-20(3)11-13-24/h10-15,19,21-22,26,32H,8,16-18H2,1-6H3/t21-,22-,26+/m1/s1 |
| InChIKey | ZMKGIMZFDWFNMR-DRLORSAXSA-N |
| XLogP | 3.33 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|