C13H22N2O3 — CID 4690414
propan-2-yl 2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)acetate (PubChem CID 4690414) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is propan-2-yl 2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)acetate.
| Compound Name | propan-2-yl 2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)acetate |
|---|---|
| PubChem CID | 4690414 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | propan-2-yl 2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)acetate |
| SMILES | CC(C)OC(=O)CC1NC2CCCCC2NC1=O |
| InChI | InChI=1S/C13H22N2O3/c1-8(2)18-12(16)7-11-13(17)15-10-6-4-3-5-9(10)14-11/h8-11,14H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | ZONDAFXFVFSORE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |