C28H27N3O7S2 — CID 46904267
[(3aS,4aR,7aS,8aR)-4a-hydroxy-6-(4-methylphenyl)sulfonyl-1,3-dioxo-2-phenyl-3a,4,5,7,8,8a-hexahydropyrrolo[3,4-f]isoindol-7a-yl] N-thiophen-2-ylcarbamate (PubChem CID 46904267) has the molecular formula C28H27N3O7S2 and a molecular weight of 581.67 g/mol. Its IUPAC name is [(3aS,4aR,7aS,8aR)-4a-hydroxy-6-(4-methylphenyl)sulfonyl-1,3-dioxo-2-phenyl-3a,4,5,7,8,8a-hexahydropyrrolo[3,4-f]isoindol-7a-yl] N-thiophen-2-ylcarbamate.
| Compound Name | [(3aS,4aR,7aS,8aR)-4a-hydroxy-6-(4-methylphenyl)sulfonyl-1,3-dioxo-2-phenyl-3a,4,5,7,8,8a-hexahydropyrrolo[3,4-f]isoindol-7a-yl] N-thiophen-2-ylcarbamate |
|---|---|
| PubChem CID | 46904267 |
| Molecular Formula | C28H27N3O7S2 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | [(3aS,4aR,7aS,8aR)-4a-hydroxy-6-(4-methylphenyl)sulfonyl-1,3-dioxo-2-phenyl-3a,4,5,7,8,8a-hexahydropyrrolo[3,4-f]isoindol-7a-yl] N-thiophen-2-ylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]3(O)C[C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]4C[C@]3(OC(=O)Nc3cccs3)C2)cc1 |
| InChI | InChI=1S/C28H27N3O7S2/c1-18-9-11-20(12-10-18)40(36,37)30-16-27(35)14-21-22(25(33)31(24(21)32)19-6-3-2-4-7-19)15-28(27,17-30)38-26(34)29-23-8-5-13-39-23/h2-13,21-22,35H,14-17H2,1H3,(H,29,34)/t21-,22+,27+,28-/m0/s1 |
| InChIKey | LQQGRTNZVHOCBC-IZHPJMONSA-N |
| XLogP | 3.38 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|