C37H40N2O5S2 — CID 46904370
(2S,4aR,7S,8aS)-7-(4-ethylphenyl)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 46904370) has the molecular formula C37H40N2O5S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-7-(4-ethylphenyl)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-7-(4-ethylphenyl)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 46904370 |
| Molecular Formula | C37H40N2O5S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | (2S,4aR,7S,8aS)-7-(4-ethylphenyl)-2-(4-methylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | CCc1ccc([C@@H]2C[C@H]3[C@@H](CN2S(=O)(=O)c2ccc(C)cc2)C(=O)C[C@@H](c2ccc(C)cc2)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H40N2O5S2/c1-5-28-12-16-29(17-13-28)34-22-36-33(24-38(34)45(41,42)31-18-8-26(3)9-19-31)37(40)23-35(30-14-6-25(2)7-15-30)39(36)46(43,44)32-20-10-27(4)11-21-32/h6-21,33-36H,5,22-24H2,1-4H3/t33-,34+,35+,36+/m1/s1 |
| InChIKey | QFQVWZZRWBPAGV-WISKXVKBSA-N |
| XLogP | 6.70 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |