C28H21N3O3 — CID 46904465
14-benzyl-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione (PubChem CID 46904465) has the molecular formula C28H21N3O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is 14-benzyl-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione.
| Compound Name | 14-benzyl-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione |
|---|---|
| PubChem CID | 46904465 |
| Molecular Formula | C28H21N3O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 14-benzyl-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione |
| SMILES | COc1ccc2nc3n(c(=O)c2c1)-c1cc2ccccc2cc1C(=O)NC3Cc1ccccc1 |
| InChI | InChI=1S/C28H21N3O3/c1-34-20-11-12-23-21(16-20)28(33)31-25-15-19-10-6-5-9-18(19)14-22(25)27(32)30-24(26(31)29-23)13-17-7-3-2-4-8-17/h2-12,14-16,24H,13H2,1H3,(H,30,32) |
| InChIKey | STWYZUMJQANYOH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |