C28H21N3O4 — CID 46904476
14-[(4-hydroxyphenyl)methyl]-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione (PubChem CID 46904476) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is 14-[(4-hydroxyphenyl)methyl]-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione.
| Compound Name | 14-[(4-hydroxyphenyl)methyl]-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione |
|---|---|
| PubChem CID | 46904476 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 14-[(4-hydroxyphenyl)methyl]-20-methoxy-1,13,16-triazapentacyclo[13.8.0.02,11.04,9.017,22]tricosa-2,4,6,8,10,15,17(22),18,20-nonaene-12,23-dione |
| SMILES | COc1ccc2nc3n(c(=O)c2c1)-c1cc2ccccc2cc1C(=O)NC3Cc1ccc(O)cc1 |
| InChI | InChI=1S/C28H21N3O4/c1-35-20-10-11-23-21(15-20)28(34)31-25-14-18-5-3-2-4-17(18)13-22(25)27(33)30-24(26(31)29-23)12-16-6-8-19(32)9-7-16/h2-11,13-15,24,32H,12H2,1H3,(H,30,33) |
| InChIKey | UQFDEHGRVNTACS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |