About ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate
ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate (PubChem CID 46904762) has the molecular formula C26H30N2O3
and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate |
| PubChem CID | 46904762 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(C2=C(CNC(C)=O)[C@H]3CC[C@@H](C2)N3Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-31-26(30)21-11-7-10-20(14-21)23-15-22-12-13-25(24(23)16-27-18(2)29)28(22)17-19-8-5-4-6-9-19/h4-11,14,22,25H,3,12-13,15-17H2,1-2H3,(H,27,29)/t22-,25+/m0/s1 |
| InChIKey | KMDYPBHPFUCPMT-WIOPSUGQSA-N |
| XLogP | 4.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate?
The IUPAC name of ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate (CID 46904762) is ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate.
What is the SMILES notation for ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate?
The canonical SMILES for ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate is CCOC(=O)c1cccc(C2=C(CNC(C)=O)[C@H]3CC[C@@H](C2)N3Cc2ccccc2)c1.
What is the InChIKey of ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate?
The InChIKey is KMDYPBHPFUCPMT-WIOPSUGQSA-N. The full InChI is InChI=1S/C26H30N2O3/c1-3-31-26(30)21-11-7-10-20(14-21)23-15-22-12-13-25(24(23)16-27-18(2)29)28(22)17-19-8-5-4-6-9-19/h4-11,14,22,25H,3,12-13,15-17H2,1-2H3,(H,27,29)/t22-,25+/m0/s1.
What are the key properties of ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate?
ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate has a molecular weight of 418.54 g/mol, XLogP of 4.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(1R,5S)-2-(acetamidomethyl)-8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl]benzoate is sourced from PubChem (CID 46904762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).