About [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate
[4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate (PubChem CID 46904833) has the molecular formula C23H19F3O4
and a molecular weight of 416.40 g/mol. Its IUPAC name is [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate |
| PubChem CID | 46904833 |
| Molecular Formula | C23H19F3O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate |
| SMILES | CC1(C)CC(=O)C=C(c2ccc(COC(=O)c3cccc(C(F)(F)F)c3)cc2)C1=O |
| InChI | InChI=1S/C23H19F3O4/c1-22(2)12-18(27)11-19(20(22)28)15-8-6-14(7-9-15)13-30-21(29)16-4-3-5-17(10-16)23(24,25)26/h3-11H,12-13H2,1-2H3 |
| InChIKey | BYCXQYHLYBCMBY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate?
The IUPAC name of [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate (CID 46904833) is [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate.
What is the SMILES notation for [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate?
The canonical SMILES for [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate is CC1(C)CC(=O)C=C(c2ccc(COC(=O)c3cccc(C(F)(F)F)c3)cc2)C1=O.
What is the InChIKey of [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate?
The InChIKey is BYCXQYHLYBCMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F3O4/c1-22(2)12-18(27)11-19(20(22)28)15-8-6-14(7-9-15)13-30-21(29)16-4-3-5-17(10-16)23(24,25)26/h3-11H,12-13H2,1-2H3.
What are the key properties of [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate?
[4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate has a molecular weight of 416.40 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl]methyl 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 46904833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).