About [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate (PubChem CID 46904840) has the molecular formula C21H26O4
and a molecular weight of 342.44 g/mol. Its IUPAC name is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate.
Molecular Properties
| Compound Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate |
| PubChem CID | 46904840 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1cccc(C2=CC(=O)CC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C21H26O4/c1-4-5-6-7-11-19(23)25-17-10-8-9-15(12-17)18-13-16(22)14-21(2,3)20(18)24/h8-10,12-13H,4-7,11,14H2,1-3H3 |
| InChIKey | ANBBAEKKDHDIAA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate?
The IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate (CID 46904840) is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate.
What is the SMILES notation for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate?
The canonical SMILES for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate is CCCCCCC(=O)Oc1cccc(C2=CC(=O)CC(C)(C)C2=O)c1.
What is the InChIKey of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate?
The InChIKey is ANBBAEKKDHDIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O4/c1-4-5-6-7-11-19(23)25-17-10-8-9-15(12-17)18-13-16(22)14-21(2,3)20(18)24/h8-10,12-13H,4-7,11,14H2,1-3H3.
What are the key properties of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate?
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate has a molecular weight of 342.44 g/mol, XLogP of 4.51, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] heptanoate is sourced from PubChem (CID 46904840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).