About [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate (PubChem CID 46904841) has the molecular formula C27H22O4
and a molecular weight of 410.47 g/mol. Its IUPAC name is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate |
| PubChem CID | 46904841 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate |
| SMILES | CC1(C)CC(=O)C=C(c2cccc(OC(=O)c3ccc(-c4ccccc4)cc3)c2)C1=O |
| InChI | InChI=1S/C27H22O4/c1-27(2)17-22(28)16-24(25(27)29)21-9-6-10-23(15-21)31-26(30)20-13-11-19(12-14-20)18-7-4-3-5-8-18/h3-16H,17H2,1-2H3 |
| InChIKey | FOPOMRUCMCJBCW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate?
The IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate (CID 46904841) is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate.
What is the SMILES notation for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate?
The canonical SMILES for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate is CC1(C)CC(=O)C=C(c2cccc(OC(=O)c3ccc(-c4ccccc4)cc3)c2)C1=O.
What is the InChIKey of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate?
The InChIKey is FOPOMRUCMCJBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22O4/c1-27(2)17-22(28)16-24(25(27)29)21-9-6-10-23(15-21)31-26(30)20-13-11-19(12-14-20)18-7-4-3-5-8-18/h3-16H,17H2,1-2H3.
What are the key properties of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate?
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate has a molecular weight of 410.47 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-phenylbenzoate is sourced from PubChem (CID 46904841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).