About [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate (PubChem CID 46904842) has the molecular formula C21H17BrO4
and a molecular weight of 413.27 g/mol. Its IUPAC name is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate |
| PubChem CID | 46904842 |
| Molecular Formula | C21H17BrO4 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate |
| SMILES | CC1(C)CC(=O)C=C(c2cccc(OC(=O)c3ccc(Br)cc3)c2)C1=O |
| InChI | InChI=1S/C21H17BrO4/c1-21(2)12-16(23)11-18(19(21)24)14-4-3-5-17(10-14)26-20(25)13-6-8-15(22)9-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | VEDMXCBKKGKJMH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate?
The IUPAC name of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate (CID 46904842) is [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate.
What is the SMILES notation for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate?
The canonical SMILES for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate is CC1(C)CC(=O)C=C(c2cccc(OC(=O)c3ccc(Br)cc3)c2)C1=O.
What is the InChIKey of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate?
The InChIKey is VEDMXCBKKGKJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17BrO4/c1-21(2)12-16(23)11-18(19(21)24)14-4-3-5-17(10-14)26-20(25)13-6-8-15(22)9-7-13/h3-11H,12H2,1-2H3.
What are the key properties of [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate?
[3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate has a molecular weight of 413.27 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5,5-dimethyl-3,6-dioxocyclohexen-1-yl)phenyl] 4-bromobenzoate is sourced from PubChem (CID 46904842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).