About 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione
6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione (PubChem CID 46904845) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione |
| PubChem CID | 46904845 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione |
| SMILES | CC1(C)CC(=O)C=C(c2ccc(-c3cnc4ccccc4c3)cc2)C1=O |
| InChI | InChI=1S/C23H19NO2/c1-23(2)13-19(25)12-20(22(23)26)16-9-7-15(8-10-16)18-11-17-5-3-4-6-21(17)24-14-18/h3-12,14H,13H2,1-2H3 |
| InChIKey | OFVYGCLVPWTVFS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione?
The IUPAC name of 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione (CID 46904845) is 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione.
What is the SMILES notation for 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione?
The canonical SMILES for 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione is CC1(C)CC(=O)C=C(c2ccc(-c3cnc4ccccc4c3)cc2)C1=O.
What is the InChIKey of 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione?
The InChIKey is OFVYGCLVPWTVFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2/c1-23(2)13-19(25)12-20(22(23)26)16-9-7-15(8-10-16)18-11-17-5-3-4-6-21(17)24-14-18/h3-12,14H,13H2,1-2H3.
What are the key properties of 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione?
6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione has a molecular weight of 341.41 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2-(4-quinolin-3-ylphenyl)cyclohex-2-ene-1,4-dione is sourced from PubChem (CID 46904845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).