About tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate
tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 46904863) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate |
| PubChem CID | 46904863 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1CC[C@H](Cc2ccc(-n3cccc3)cc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N2O2/c1-16-7-10-19(23(16)20(24)25-21(2,3)4)15-17-8-11-18(12-9-17)22-13-5-6-14-22/h5-6,8-9,11-14,16,19H,7,10,15H2,1-4H3/t16-,19-/m1/s1 |
| InChIKey | NGIJBSOWMLGWIS-VQIMIIECSA-N |
| XLogP | 4.81 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate (CID 46904863) is tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate is C[C@@H]1CC[C@H](Cc2ccc(-n3cccc3)cc2)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate?
The InChIKey is NGIJBSOWMLGWIS-VQIMIIECSA-N. The full InChI is InChI=1S/C21H28N2O2/c1-16-7-10-19(23(16)20(24)25-21(2,3)4)15-17-8-11-18(12-9-17)22-13-5-6-14-22/h5-6,8-9,11-14,16,19H,7,10,15H2,1-4H3/t16-,19-/m1/s1.
What are the key properties of tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate?
tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate has a molecular weight of 340.47 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,5R)-2-methyl-5-[(4-pyrrol-1-ylphenyl)methyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 46904863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).