About 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine
6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine (PubChem CID 46904896) has the molecular formula C18H19BrN2
and a molecular weight of 343.27 g/mol. Its IUPAC name is 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine |
| PubChem CID | 46904896 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)Cc1c(-c2ccccc2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C18H19BrN2/c1-18(2,3)11-15-17(13-7-5-4-6-8-13)20-16-10-9-14(19)12-21(15)16/h4-10,12H,11H2,1-3H3 |
| InChIKey | VPKQQQCWMBRDQX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine (CID 46904896) is 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine is CC(C)(C)Cc1c(-c2ccccc2)nc2ccc(Br)cn12.
What is the InChIKey of 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine?
The InChIKey is VPKQQQCWMBRDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN2/c1-18(2,3)11-15-17(13-7-5-4-6-8-13)20-16-10-9-14(19)12-21(15)16/h4-10,12H,11H2,1-3H3.
What are the key properties of 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine?
6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine has a molecular weight of 343.27 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(2,2-dimethylpropyl)-2-phenylimidazo[1,2-a]pyridine is sourced from PubChem (CID 46904896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).