C13H9N3O — CID 46904962
9-oxa-1,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaene (PubChem CID 46904962) has the molecular formula C13H9N3O and a molecular weight of 223.24 g/mol. Its IUPAC name is 9-oxa-1,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaene.
| Compound Name | 9-oxa-1,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaene |
|---|---|
| PubChem CID | 46904962 |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 9-oxa-1,12,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,10,12,14,16-heptaene |
| SMILES | c1ccc2c(c1)COc1c3ncccc3nn1-2 |
| InChI | InChI=1S/C13H9N3O/c1-2-6-11-9(4-1)8-17-13-12-10(15-16(11)13)5-3-7-14-12/h1-7H,8H2 |
| InChIKey | UKNGZCWWROBLQU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |