C17H19N3O4 — CID 46904967
tert-butyl 3-(4-aminophenyl)-4-oxo-6,7-dihydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate (PubChem CID 46904967) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is tert-butyl 3-(4-aminophenyl)-4-oxo-6,7-dihydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-(4-aminophenyl)-4-oxo-6,7-dihydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 46904967 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | tert-butyl 3-(4-aminophenyl)-4-oxo-6,7-dihydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2onc(-c3ccc(N)cc3)c2C1=O |
| InChI | InChI=1S/C17H19N3O4/c1-17(2,3)23-16(22)20-9-8-12-13(15(20)21)14(19-24-12)10-4-6-11(18)7-5-10/h4-7H,8-9,18H2,1-3H3 |
| InChIKey | MJJDQXJVLKUGIV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|