About [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate
[4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate (PubChem CID 46905029) has the molecular formula C18H11N3O4S
and a molecular weight of 365.37 g/mol. Its IUPAC name is [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate |
| PubChem CID | 46905029 |
| Molecular Formula | C18H11N3O4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)Oc2coc(CSc3ncccn3)cc2=O)cc1 |
| InChI | InChI=1S/C18H11N3O4S/c19-9-12-2-4-13(5-3-12)17(23)25-16-10-24-14(8-15(16)22)11-26-18-20-6-1-7-21-18/h1-8,10H,11H2 |
| InChIKey | OYKOAVOVSIXRCI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 106.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate?
The IUPAC name of [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate (CID 46905029) is [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate.
What is the SMILES notation for [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate?
The canonical SMILES for [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate is N#Cc1ccc(C(=O)Oc2coc(CSc3ncccn3)cc2=O)cc1.
What is the InChIKey of [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate?
The InChIKey is OYKOAVOVSIXRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O4S/c19-9-12-2-4-13(5-3-12)17(23)25-16-10-24-14(8-15(16)22)11-26-18-20-6-1-7-21-18/h1-8,10H,11H2.
What are the key properties of [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate?
[4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate has a molecular weight of 365.37 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-6-(pyrimidin-2-ylsulfanylmethyl)pyran-3-yl] 4-cyanobenzoate is sourced from PubChem (CID 46905029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).