C25H24N6O5 — CID 46905052
2-(6,9-dimethyl-2,10-dioxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-N-[(2R)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide (PubChem CID 46905052) has the molecular formula C25H24N6O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is 2-(6,9-dimethyl-2,10-dioxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-N-[(2R)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide.
| Compound Name | 2-(6,9-dimethyl-2,10-dioxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-N-[(2R)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide |
|---|---|
| PubChem CID | 46905052 |
| Molecular Formula | C25H24N6O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-(6,9-dimethyl-2,10-dioxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-yl)-N-[(2R)-1'-methyl-2',4'-dioxospiro[1,3-dihydroindene-2,5'-imidazolidine]-5-yl]acetamide |
| SMILES | Cc1cc2c3c(c1)n(CC(=O)Nc1ccc4c(c1)C[C@]1(C4)C(=O)NC(=O)N1C)c(=O)n3CC(=O)N2C |
| InChI | InChI=1S/C25H24N6O5/c1-13-6-17-21-18(7-13)30(24(36)31(21)12-20(33)28(17)2)11-19(32)26-16-5-4-14-9-25(10-15(14)8-16)22(34)27-23(35)29(25)3/h4-8H,9-12H2,1-3H3,(H,26,32)(H,27,34,35)/t25-/m1/s1 |
| InChIKey | HDBSRIGJXCCCTQ-RUZDIDTESA-N |
| XLogP | 0.75 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|