C7H14O7S — CID 46905198
(3R,4S,5R,6S)-6-(methylsulfonylmethyl)oxane-2,3,4,5-tetrol (PubChem CID 46905198) has the molecular formula C7H14O7S and a molecular weight of 242.25 g/mol. Its IUPAC name is (3R,4S,5R,6S)-6-(methylsulfonylmethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5R,6S)-6-(methylsulfonylmethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 46905198 |
| Molecular Formula | C7H14O7S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (3R,4S,5R,6S)-6-(methylsulfonylmethyl)oxane-2,3,4,5-tetrol |
| SMILES | CS(=O)(=O)C[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O7S/c1-15(12,13)2-3-4(8)5(9)6(10)7(11)14-3/h3-11H,2H2,1H3/t3-,4+,5+,6-,7?/m1/s1 |
| InChIKey | VUAKEXWBHVCSLA-TVPFVARWSA-N |
| XLogP | -3.17 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |