C12H19F6N3O7 — CID 46905359
2-[2-(4-aminobutanoylamino)ethylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 46905359) has the molecular formula C12H19F6N3O7 and a molecular weight of 431.29 g/mol. Its IUPAC name is 2-[2-(4-aminobutanoylamino)ethylamino]acetic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[2-(4-aminobutanoylamino)ethylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 46905359 |
| Molecular Formula | C12H19F6N3O7 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[2-(4-aminobutanoylamino)ethylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCCCC(=O)NCCNCC(=O)O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H17N3O3.2C2HF3O2/c9-3-1-2-7(12)11-5-4-10-6-8(13)14;2*3-2(4,5)1(6)7/h10H,1-6,9H2,(H,11,12)(H,13,14);2*(H,6,7) |
| InChIKey | ZTBMDOARQQOPSJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|