C22H26N2O7 — CID 46905504
(Z)-but-2-enedioic acid;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-cyanophenoxy)propanoate (PubChem CID 46905504) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-cyanophenoxy)propanoate.
| Compound Name | (Z)-but-2-enedioic acid;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 46905504 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-(4-cyanophenoxy)propanoate |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)OC1CC2CCC(C1)N2C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H22N2O3.C4H4O4/c1-12(22-16-7-3-13(11-19)4-8-16)18(21)23-17-9-14-5-6-15(10-17)20(14)2;5-3(6)1-2-4(7)8/h3-4,7-8,12,14-15,17H,5-6,9-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CSBFJBVTBOSMHC-BTJKTKAUSA-N |
| XLogP | 2.21 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|