C45H70Cl2N4OP+ — CID 46905669
tributyl-[[4-[[(2S)-2-[(N,N'-dicyclohexylcarbamimidoyl)amino]-3-naphthalen-1-ylpropanoyl]amino]phenyl]methyl]phosphanium;dihydrochloride (PubChem CID 46905669) has the molecular formula C45H70Cl2N4OP+ and a molecular weight of 784.96 g/mol. Its IUPAC name is tributyl-[[4-[[(2S)-2-[(N,N'-dicyclohexylcarbamimidoyl)amino]-3-naphthalen-1-ylpropanoyl]amino]phenyl]methyl]phosphanium;dihydrochloride.
| Compound Name | tributyl-[[4-[[(2S)-2-[(N,N'-dicyclohexylcarbamimidoyl)amino]-3-naphthalen-1-ylpropanoyl]amino]phenyl]methyl]phosphanium;dihydrochloride |
|---|---|
| PubChem CID | 46905669 |
| Molecular Formula | C45H70Cl2N4OP+ |
| Molecular Weight | 784.96 g/mol |
| Exact Mass | 783.47 |
| IUPAC Name | tributyl-[[4-[[(2S)-2-[(N,N'-dicyclohexylcarbamimidoyl)amino]-3-naphthalen-1-ylpropanoyl]amino]phenyl]methyl]phosphanium;dihydrochloride |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(NC(=O)[C@H](Cc2cccc3ccccc23)N/C(=N/C2CCCCC2)NC2CCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C45H67N4OP.2ClH/c1-4-7-31-51(32-8-5-2,33-9-6-3)35-36-27-29-41(30-28-36)46-44(50)43(34-38-21-18-20-37-19-16-17-26-42(37)38)49-45(47-39-22-12-10-13-23-39)48-40-24-14-11-15-25-40;;/h16-21,26-30,39-40,43H,4-15,22-25,31-35H2,1-3H3,(H2-,46,47,48,49,50);2*1H/p+1/t43-;;/m0../s1 |
| InChIKey | QAMSJVJIZLIEED-KRFCICRISA-O |
| XLogP | 12.35 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.96 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|