C13H16N4O3 — CID 46905982
(1S,2R)-1-(2,6-diamino-5-phenylpyrimidin-4-yl)propane-1,2,3-triol (PubChem CID 46905982) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is (1S,2R)-1-(2,6-diamino-5-phenylpyrimidin-4-yl)propane-1,2,3-triol.
| Compound Name | (1S,2R)-1-(2,6-diamino-5-phenylpyrimidin-4-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 46905982 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1S,2R)-1-(2,6-diamino-5-phenylpyrimidin-4-yl)propane-1,2,3-triol |
| SMILES | Nc1nc(N)c(-c2ccccc2)c([C@H](O)[C@H](O)CO)n1 |
| InChI | InChI=1S/C13H16N4O3/c14-12-9(7-4-2-1-3-5-7)10(16-13(15)17-12)11(20)8(19)6-18/h1-5,8,11,18-20H,6H2,(H4,14,15,16,17)/t8-,11-/m1/s1 |
| InChIKey | UXUBHXPHVUZZOT-LDYMZIIASA-N |
| XLogP | -0.31 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |