C33H45NO3 — CID 46905983
(4E,7E,10E,13E,16E,19E)-1-(7-hydroxy-6-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)docosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 46905983) has the molecular formula C33H45NO3 and a molecular weight of 503.73 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E,19E)-1-(7-hydroxy-6-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)docosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4E,7E,10E,13E,16E,19E)-1-(7-hydroxy-6-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)docosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 46905983 |
| Molecular Formula | C33H45NO3 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | (4E,7E,10E,13E,16E,19E)-1-(7-hydroxy-6-methoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)docosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)N1CCc2cc(OC)c(O)cc2C1C |
| InChI | InChI=1S/C33H45NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-33(36)34-25-24-29-26-32(37-3)31(35)27-30(29)28(34)2/h5-6,8-9,11-12,14-15,17-18,20-21,26-28,35H,4,7,10,13,16,19,22-25H2,1-3H3/b6-5+,9-8+,12-11+,15-14+,18-17+,21-20+ |
| InChIKey | HYPGJPLXZOQGIJ-YATCGRJWSA-N |
| XLogP | 8.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|