C22H22N2O4 — CID 46906181
2-butanoyl-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46906181) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-butanoyl-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 2-butanoyl-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46906181 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-butanoyl-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CCCC(=O)N1C(C(=O)O)Cc2c([nH]c3ccccc23)C1c1cccc(O)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-2-6-19(26)24-18(22(27)28)12-16-15-9-3-4-10-17(15)23-20(16)21(24)13-7-5-8-14(25)11-13/h3-5,7-11,18,21,23,25H,2,6,12H2,1H3,(H,27,28) |
| InChIKey | USZCECBAQAQMSU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|