C20H22N4O2 — CID 46906232
N-(2-aminoethyl)-1-(3-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 46906232) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(3-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 46906232 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-(2-aminoethyl)-1-(3-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | NCCNC(=O)C1Cc2c([nH]c3ccccc23)C(c2cccc(O)c2)N1 |
| InChI | InChI=1S/C20H22N4O2/c21-8-9-22-20(26)17-11-15-14-6-1-2-7-16(14)23-19(15)18(24-17)12-4-3-5-13(25)10-12/h1-7,10,17-18,23-25H,8-9,11,21H2,(H,22,26) |
| InChIKey | QCKCFJTWKWDFDH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|