C20H21Cl2N3O2 — CID 46906233
2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one;hydrochloride (PubChem CID 46906233) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one;hydrochloride.
| Compound Name | 2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 46906233 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-amino-1-[6-chloro-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one;hydrochloride |
| SMILES | CC(N)C(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(O)c1.Cl |
| InChI | InChI=1S/C20H20ClN3O2.ClH/c1-11(22)20(26)24-8-7-15-16-10-13(21)5-6-17(16)23-18(15)19(24)12-3-2-4-14(25)9-12;/h2-6,9-11,19,23,25H,7-8,22H2,1H3;1H |
| InChIKey | AZJCZEZHRKVWAX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|