C20H24ClN3O — CID 46906287
3-[2-(2-aminoethyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride (PubChem CID 46906287) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 3-[2-(2-aminoethyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride.
| Compound Name | 3-[2-(2-aminoethyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 46906287 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[2-(2-aminoethyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(CCN)C3c1cccc(O)c1.Cl |
| InChI | InChI=1S/C20H23N3O.ClH/c1-13-5-6-18-17(11-13)16-7-9-23(10-8-21)20(19(16)22-18)14-3-2-4-15(24)12-14;/h2-6,11-12,20,22,24H,7-10,21H2,1H3;1H |
| InChIKey | ILZIULCMOOXKIH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|