C22H28ClN3O — CID 46906291
3-[2-(4-aminobutyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride (PubChem CID 46906291) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 3-[2-(4-aminobutyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride.
| Compound Name | 3-[2-(4-aminobutyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 46906291 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-[2-(4-aminobutyl)-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol;hydrochloride |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(CCCCN)C3c1cccc(O)c1.Cl |
| InChI | InChI=1S/C22H27N3O.ClH/c1-15-7-8-20-19(13-15)18-9-12-25(11-3-2-10-23)22(21(18)24-20)16-5-4-6-17(26)14-16;/h4-8,13-14,22,24,26H,2-3,9-12,23H2,1H3;1H |
| InChIKey | WEBKXJQYYGVMJI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|