C35H36N2O7 — CID 46906299
(Z)-4-[3-[[4-[[6-[(3,5-dimethylphenyl)methyl]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methoxymethyl]phenyl]methyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 46906299) has the molecular formula C35H36N2O7 and a molecular weight of 596.68 g/mol. Its IUPAC name is (Z)-4-[3-[[4-[[6-[(3,5-dimethylphenyl)methyl]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methoxymethyl]phenyl]methyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[3-[[4-[[6-[(3,5-dimethylphenyl)methyl]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methoxymethyl]phenyl]methyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 46906299 |
| Molecular Formula | C35H36N2O7 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (Z)-4-[3-[[4-[[6-[(3,5-dimethylphenyl)methyl]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methoxymethyl]phenyl]methyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | Cc1cc(C)cc(Cc2c(C(C)C)c(=O)[nH]c(=O)n2COCc2ccc(Cc3cccc(/C(O)=C/C(=O)C(=O)O)c3)cc2)c1 |
| InChI | InChI=1S/C35H36N2O7/c1-21(2)32-29(17-27-13-22(3)12-23(4)14-27)37(35(43)36-33(32)40)20-44-19-25-10-8-24(9-11-25)15-26-6-5-7-28(16-26)30(38)18-31(39)34(41)42/h5-14,16,18,21,38H,15,17,19-20H2,1-4H3,(H,41,42)(H,36,40,43)/b30-18- |
| InChIKey | MZVRTVGPWDNJKI-YKQZZPSBSA-N |
| XLogP | 5.19 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|