C23H22ClN3O — CID 46906361
1-[6-chloro-1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one (PubChem CID 46906361) has the molecular formula C23H22ClN3O and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[6-chloro-1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one.
| Compound Name | 1-[6-chloro-1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 46906361 |
| Molecular Formula | C23H22ClN3O |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[6-chloro-1-(1H-indol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H22ClN3O/c1-2-5-21(28)27-11-10-16-17-12-14(24)8-9-20(17)26-22(16)23(27)18-13-25-19-7-4-3-6-15(18)19/h3-4,6-9,12-13,23,25-26H,2,5,10-11H2,1H3 |
| InChIKey | AYAWZIKJMLSOJF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|