C15H24O3 — CID 46906381
(1S,2R,4S,7S,8R,11R)-11-hydroxy-2,4,8-trimethyltricyclo[5.3.1.04,11]undecane-2-carboxylic acid (PubChem CID 46906381) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2R,4S,7S,8R,11R)-11-hydroxy-2,4,8-trimethyltricyclo[5.3.1.04,11]undecane-2-carboxylic acid.
| Compound Name | (1S,2R,4S,7S,8R,11R)-11-hydroxy-2,4,8-trimethyltricyclo[5.3.1.04,11]undecane-2-carboxylic acid |
|---|---|
| PubChem CID | 46906381 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2R,4S,7S,8R,11R)-11-hydroxy-2,4,8-trimethyltricyclo[5.3.1.04,11]undecane-2-carboxylic acid |
| SMILES | C[C@@H]1CC[C@@H]2[C@]3(O)[C@H]1CC[C@@]3(C)C[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C15H24O3/c1-9-4-5-11-14(3,12(16)17)8-13(2)7-6-10(9)15(11,13)18/h9-11,18H,4-8H2,1-3H3,(H,16,17)/t9-,10+,11+,13+,14-,15-/m1/s1 |
| InChIKey | HJIXPIWBGQEXMJ-AWOLGQDMSA-N |
| XLogP | 2.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |