C22H26ClN3O — CID 46906385
2-[6-chloro-1-(3-propan-2-yloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanamine (PubChem CID 46906385) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-[6-chloro-1-(3-propan-2-yloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanamine.
| Compound Name | 2-[6-chloro-1-(3-propan-2-yloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanamine |
|---|---|
| PubChem CID | 46906385 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[6-chloro-1-(3-propan-2-yloxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanamine |
| SMILES | CC(C)Oc1cccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2CCN)c1 |
| InChI | InChI=1S/C22H26ClN3O/c1-14(2)27-17-5-3-4-15(12-17)22-21-18(8-10-26(22)11-9-24)19-13-16(23)6-7-20(19)25-21/h3-7,12-14,22,25H,8-11,24H2,1-2H3 |
| InChIKey | MSLQGLFYYFSOHT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|