About 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol
1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol (PubChem CID 46906492) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol.
Molecular Properties
| Compound Name | 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol |
| PubChem CID | 46906492 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol |
| SMILES | CCC(O)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C11H17NO3/c1-4-9(13)7-5-10(14-2)11(15-3)6-8(7)12/h5-6,9,13H,4,12H2,1-3H3 |
| InChIKey | HDCYLJLONIEINZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol?
The IUPAC name of 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol (CID 46906492) is 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol.
What is the SMILES notation for 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol?
The canonical SMILES for 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol is CCC(O)c1cc(OC)c(OC)cc1N.
What is the InChIKey of 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol?
The InChIKey is HDCYLJLONIEINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-4-9(13)7-5-10(14-2)11(15-3)6-8(7)12/h5-6,9,13H,4,12H2,1-3H3.
What are the key properties of 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol?
1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol has a molecular weight of 211.26 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4,5-dimethoxyphenyl)propan-1-ol is sourced from PubChem (CID 46906492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).