About 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine
9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine (PubChem CID 46906544) has the molecular formula C12H11ClN4
and a molecular weight of 246.70 g/mol. Its IUPAC name is 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine.
Molecular Properties
| Compound Name | 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine |
| PubChem CID | 46906544 |
| Molecular Formula | C12H11ClN4 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine |
| SMILES | Clc1ncnc2c1ncn2[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H11ClN4/c13-11-10-12(15-5-14-11)17(6-16-10)9-4-7-1-2-8(9)3-7/h1-2,5-9H,3-4H2/t7-,8+,9+/m1/s1 |
| InChIKey | NEGLPABBXCHFHQ-VGMNWLOBSA-N |
| XLogP | 2.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine?
The IUPAC name of 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine (CID 46906544) is 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine.
What is the SMILES notation for 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine?
The canonical SMILES for 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine is Clc1ncnc2c1ncn2[C@H]1C[C@@H]2C=C[C@H]1C2.
What is the InChIKey of 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine?
The InChIKey is NEGLPABBXCHFHQ-VGMNWLOBSA-N. The full InChI is InChI=1S/C12H11ClN4/c13-11-10-12(15-5-14-11)17(6-16-10)9-4-7-1-2-8(9)3-7/h1-2,5-9H,3-4H2/t7-,8+,9+/m1/s1.
What are the key properties of 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine?
9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine has a molecular weight of 246.70 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-6-chloropurine is sourced from PubChem (CID 46906544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).