C33H30BrNO4S — CID 46906766
17-methoxy-16-(4-naphthalen-2-ylsulfanylbutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide (PubChem CID 46906766) has the molecular formula C33H30BrNO4S and a molecular weight of 616.58 g/mol. Its IUPAC name is 17-methoxy-16-(4-naphthalen-2-ylsulfanylbutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide.
| Compound Name | 17-methoxy-16-(4-naphthalen-2-ylsulfanylbutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
|---|---|
| PubChem CID | 46906766 |
| Molecular Formula | C33H30BrNO4S |
| Molecular Weight | 616.58 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | 17-methoxy-16-(4-naphthalen-2-ylsulfanylbutoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCSc1ccc2ccccc2c1)CCc1cc2c(cc1-3)OCO2.[Br-] |
| InChI | InChI=1S/C33H30NO4S.BrH/c1-35-30-11-9-24-17-29-27-19-32-31(37-21-38-32)18-25(27)12-13-34(29)20-28(24)33(30)36-14-4-5-15-39-26-10-8-22-6-2-3-7-23(22)16-26;/h2-3,6-11,16-20H,4-5,12-15,21H2,1H3;1H/q+1;/p-1 |
| InChIKey | LRMHGTVTCRTHQG-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|