C17H17IN2S — CID 46906800
1,3-dimethyl-2-[(E)-2-(4-phenylthiophen-2-yl)ethenyl]imidazol-1-ium iodide (PubChem CID 46906800) has the molecular formula C17H17IN2S and a molecular weight of 408.31 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(E)-2-(4-phenylthiophen-2-yl)ethenyl]imidazol-1-ium iodide.
| Compound Name | 1,3-dimethyl-2-[(E)-2-(4-phenylthiophen-2-yl)ethenyl]imidazol-1-ium iodide |
|---|---|
| PubChem CID | 46906800 |
| Molecular Formula | C17H17IN2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1,3-dimethyl-2-[(E)-2-(4-phenylthiophen-2-yl)ethenyl]imidazol-1-ium iodide |
| SMILES | Cn1cc[n+](C)c1/C=C/c1cc(-c2ccccc2)cs1.[I-] |
| InChI | InChI=1S/C17H17N2S.HI/c1-18-10-11-19(2)17(18)9-8-16-12-15(13-20-16)14-6-4-3-5-7-14;/h3-13H,1-2H3;1H/q+1;/p-1/b9-8+; |
| InChIKey | GPDCJKPGBNMBRB-HRNDJLQDSA-M |
| XLogP | 0.75 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|