C21H20N3O2+ — CID 46906808
N-(3-methylphenyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]benzamide (PubChem CID 46906808) has the molecular formula C21H20N3O2+ and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]benzamide.
| Compound Name | N-(3-methylphenyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 46906808 |
| Molecular Formula | C21H20N3O2+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(3-methylphenyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(NC(=O)C[n+]3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-16-7-5-9-18(13-16)23-21(26)17-8-6-10-19(14-17)22-20(25)15-24-11-3-2-4-12-24/h2-14H,15H2,1H3,(H-,22,23,25,26)/p+1 |
| InChIKey | PJXJIWIIGKPYFH-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|