C21H32O4 — CID 46907077
(1R,4R,5R,8R,9S,10S,13S,14S)-8-hydroxy-14-methoxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid (PubChem CID 46907077) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,4R,5R,8R,9S,10S,13S,14S)-8-hydroxy-14-methoxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid.
| Compound Name | (1R,4R,5R,8R,9S,10S,13S,14S)-8-hydroxy-14-methoxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 46907077 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,4R,5R,8R,9S,10S,13S,14S)-8-hydroxy-14-methoxy-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadec-11-ene-5-carboxylic acid |
| SMILES | CO[C@@]1(C)C[C@]23CC[C@@H]4[C@](C)([C@H](O)CC[C@@]4(C)C(=O)O)[C@H]2C=C[C@@H]1C3 |
| InChI | InChI=1S/C21H32O4/c1-18(17(23)24)9-8-16(22)20(3)14(18)7-10-21-11-13(5-6-15(20)21)19(2,12-21)25-4/h5-6,13-16,22H,7-12H2,1-4H3,(H,23,24)/t13-,14+,15-,16-,18-,19+,20+,21-/m1/s1 |
| InChIKey | JMCDUBQYQMSCGT-YLKIOQGFSA-N |
| XLogP | 3.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|